C23H18N2O4S — CID 24945331
5-[2-[4-(4-methoxyphenyl)phenyl]sulfanylphenyl]-1,3-diazinane-2,4,6-trione (PubChem CID 24945331) has the molecular formula C23H18N2O4S and a molecular weight of 418.47 g/mol. Its IUPAC name is 5-[2-[4-(4-methoxyphenyl)phenyl]sulfanylphenyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[2-[4-(4-methoxyphenyl)phenyl]sulfanylphenyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 24945331 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 5-[2-[4-(4-methoxyphenyl)phenyl]sulfanylphenyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(-c2ccc(Sc3ccccc3C3C(=O)NC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C23H18N2O4S/c1-29-16-10-6-14(7-11-16)15-8-12-17(13-9-15)30-19-5-3-2-4-18(19)20-21(26)24-23(28)25-22(20)27/h2-13,20H,1H3,(H2,24,25,26,27,28) |
| InChIKey | LYYRVYNSUCVGHR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|