About 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone
3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone (PubChem CID 24945460) has the molecular formula C12H17N3O3
and a molecular weight of 251.29 g/mol. Its IUPAC name is 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone.
Molecular Properties
| Compound Name | 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone |
| PubChem CID | 24945460 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone |
| SMILES | COc1cc(C(=O)N2CC3CNCC(C3)C2)on1 |
| InChI | InChI=1S/C12H17N3O3/c1-17-11-3-10(18-14-11)12(16)15-6-8-2-9(7-15)5-13-4-8/h3,8-9,13H,2,4-7H2,1H3 |
| InChIKey | RCDYEIPQLIIGIL-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone?
The IUPAC name of 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone (CID 24945460) is 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone.
What is the SMILES notation for 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone?
The canonical SMILES for 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone is COc1cc(C(=O)N2CC3CNCC(C3)C2)on1.
What is the InChIKey of 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone?
The InChIKey is RCDYEIPQLIIGIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3/c1-17-11-3-10(18-14-11)12(16)15-6-8-2-9(7-15)5-13-4-8/h3,8-9,13H,2,4-7H2,1H3.
What are the key properties of 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone?
3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone has a molecular weight of 251.29 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-diazabicyclo[3.3.1]nonan-3-yl-(3-methoxy-1,2-oxazol-5-yl)methanone is sourced from PubChem (CID 24945460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).