C31H40N2O4 — CID 24945674
5-[4-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]phenoxy]-2,2-dimethylpentanoic acid (PubChem CID 24945674) has the molecular formula C31H40N2O4 and a molecular weight of 504.67 g/mol. Its IUPAC name is 5-[4-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]phenoxy]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[4-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]phenoxy]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 24945674 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 5-[4-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]phenoxy]-2,2-dimethylpentanoic acid |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccc(OCCCC(C)(C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H40N2O4/c1-4-5-9-27-32-31(19-6-7-20-31)28(34)33(27)22-23-10-12-24(13-11-23)25-14-16-26(17-15-25)37-21-8-18-30(2,3)29(35)36/h10-17H,4-9,18-22H2,1-3H3,(H,35,36) |
| InChIKey | DJUWWJDZSSKTOW-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|