C34H36F3NO6 — CID 24946574
1-[[3-(cyclopropylmethoxy)-5-[3-(2-methoxyethoxy)propoxy]phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid (PubChem CID 24946574) has the molecular formula C34H36F3NO6 and a molecular weight of 611.66 g/mol. Its IUPAC name is 1-[[3-(cyclopropylmethoxy)-5-[3-(2-methoxyethoxy)propoxy]phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid.
| Compound Name | 1-[[3-(cyclopropylmethoxy)-5-[3-(2-methoxyethoxy)propoxy]phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 24946574 |
| Molecular Formula | C34H36F3NO6 |
| Molecular Weight | 611.66 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | 1-[[3-(cyclopropylmethoxy)-5-[3-(2-methoxyethoxy)propoxy]phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid |
| SMILES | COCCOCCCOc1cc(Cn2c(C(=O)O)c(Cc3cccc(C(F)(F)F)c3)c3ccccc32)cc(OCC2CC2)c1 |
| InChI | InChI=1S/C34H36F3NO6/c1-41-14-15-42-12-5-13-43-27-17-25(18-28(20-27)44-22-23-10-11-23)21-38-31-9-3-2-8-29(31)30(32(38)33(39)40)19-24-6-4-7-26(16-24)34(35,36)37/h2-4,6-9,16-18,20,23H,5,10-15,19,21-22H2,1H3,(H,39,40) |
| InChIKey | UYMOJZWVJWGHGD-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.66 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|