About 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole
4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole (PubChem CID 24946587) has the molecular formula C22H24FO5PS
and a molecular weight of 450.47 g/mol. Its IUPAC name is 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole.
Molecular Properties
| Compound Name | 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole |
| PubChem CID | 24946587 |
| Molecular Formula | C22H24FO5PS |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole |
| SMILES | CCOP(=O)(OCC)C(Cc1cc(F)cc2c1OCO2)c1sc2ccccc2c1C |
| InChI | InChI=1S/C22H24FO5PS/c1-4-27-29(24,28-5-2)19(22-14(3)17-8-6-7-9-20(17)30-22)11-15-10-16(23)12-18-21(15)26-13-25-18/h6-10,12,19H,4-5,11,13H2,1-3H3 |
| InChIKey | FJYQGTOQAYABGN-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole?
The IUPAC name of 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole (CID 24946587) is 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole.
What is the SMILES notation for 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole?
The canonical SMILES for 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole is CCOP(=O)(OCC)C(Cc1cc(F)cc2c1OCO2)c1sc2ccccc2c1C.
What is the InChIKey of 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole?
The InChIKey is FJYQGTOQAYABGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24FO5PS/c1-4-27-29(24,28-5-2)19(22-14(3)17-8-6-7-9-20(17)30-22)11-15-10-16(23)12-18-21(15)26-13-25-18/h6-10,12,19H,4-5,11,13H2,1-3H3.
What are the key properties of 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole?
4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole has a molecular weight of 450.47 g/mol, XLogP of 6.63, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-diethoxyphosphoryl-2-(3-methyl-1-benzothiophen-2-yl)ethyl]-6-fluoro-1,3-benzodioxole is sourced from PubChem (CID 24946587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).