About 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one
3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one (PubChem CID 24946598) has the molecular formula C19H13F3N4OS
and a molecular weight of 402.40 g/mol. Its IUPAC name is 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one |
| PubChem CID | 24946598 |
| Molecular Formula | C19H13F3N4OS |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c(C(F)(F)F)nccc2nc(-c2cscn2)n1CCc1ccccc1 |
| InChI | InChI=1S/C19H13F3N4OS/c20-19(21,22)16-15-13(6-8-23-16)25-17(14-10-28-11-24-14)26(18(15)27)9-7-12-4-2-1-3-5-12/h1-6,8,10-11H,7,9H2 |
| InChIKey | LNEHLQGPCMJMOI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one?
The IUPAC name of 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one (CID 24946598) is 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one.
What is the SMILES notation for 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one?
The canonical SMILES for 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one is O=c1c2c(C(F)(F)F)nccc2nc(-c2cscn2)n1CCc1ccccc1.
What is the InChIKey of 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one?
The InChIKey is LNEHLQGPCMJMOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F3N4OS/c20-19(21,22)16-15-13(6-8-23-16)25-17(14-10-28-11-24-14)26(18(15)27)9-7-12-4-2-1-3-5-12/h1-6,8,10-11H,7,9H2.
What are the key properties of 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one?
3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one has a molecular weight of 402.40 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-phenylethyl)-2-(1,3-thiazol-4-yl)-5-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-one is sourced from PubChem (CID 24946598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).