About 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride
8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride (PubChem CID 24946753) has the molecular formula C14H16Cl3N5O
and a molecular weight of 376.68 g/mol. Its IUPAC name is 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride |
| PubChem CID | 24946753 |
| Molecular Formula | C14H16Cl3N5O |
| Molecular Weight | 376.68 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1nc(N2CCNCC2)c2oc3ccc(Cl)cc3c2n1 |
| InChI | InChI=1S/C14H14ClN5O.2ClH/c15-8-1-2-10-9(7-8)11-12(21-10)13(19-14(16)18-11)20-5-3-17-4-6-20;;/h1-2,7,17H,3-6H2,(H2,16,18,19);2*1H |
| InChIKey | SUUVSGCJMAMDQF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride?
The IUPAC name of 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride (CID 24946753) is 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride.
What is the SMILES notation for 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride?
The canonical SMILES for 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride is Cl.Cl.Nc1nc(N2CCNCC2)c2oc3ccc(Cl)cc3c2n1.
What is the InChIKey of 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride?
The InChIKey is SUUVSGCJMAMDQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClN5O.2ClH/c15-8-1-2-10-9(7-8)11-12(21-10)13(19-14(16)18-11)20-5-3-17-4-6-20;;/h1-2,7,17H,3-6H2,(H2,16,18,19);2*1H.
What are the key properties of 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride?
8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride has a molecular weight of 376.68 g/mol, XLogP of 2.86, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-4-piperazin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-amine;dihydrochloride is sourced from PubChem (CID 24946753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).