C23H25N3O4S — CID 2494695
[3-(dimethylsulfamoyl)phenyl]methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate (PubChem CID 2494695) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is [3-(dimethylsulfamoyl)phenyl]methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [3-(dimethylsulfamoyl)phenyl]methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2494695 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [3-(dimethylsulfamoyl)phenyl]methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)OCc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C23H25N3O4S/c1-17-22(18(2)26(24-17)20-10-6-5-7-11-20)13-14-23(27)30-16-19-9-8-12-21(15-19)31(28,29)25(3)4/h5-15H,16H2,1-4H3/b14-13+ |
| InChIKey | LMCKWTCVCCGGCB-BUHFOSPRSA-N |
| XLogP | 3.50 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|