C23H27F2O3PS — CID 24947477
2-[2-(3,4-difluorophenyl)-1-di(propan-2-yloxy)phosphorylethyl]-3-methyl-1-benzothiophene (PubChem CID 24947477) has the molecular formula C23H27F2O3PS and a molecular weight of 452.50 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)-1-di(propan-2-yloxy)phosphorylethyl]-3-methyl-1-benzothiophene.
| Compound Name | 2-[2-(3,4-difluorophenyl)-1-di(propan-2-yloxy)phosphorylethyl]-3-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 24947477 |
| Molecular Formula | C23H27F2O3PS |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)-1-di(propan-2-yloxy)phosphorylethyl]-3-methyl-1-benzothiophene |
| SMILES | Cc1c(C(Cc2ccc(F)c(F)c2)P(=O)(OC(C)C)OC(C)C)sc2ccccc12 |
| InChI | InChI=1S/C23H27F2O3PS/c1-14(2)27-29(26,28-15(3)4)21(13-17-10-11-19(24)20(25)12-17)23-16(5)18-8-6-7-9-22(18)30-23/h6-12,14-15,21H,13H2,1-5H3 |
| InChIKey | DQBJKVNKQOHWGV-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|