About N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide
N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide (PubChem CID 24947610) has the molecular formula C20H32N2O2
and a molecular weight of 332.49 g/mol. Its IUPAC name is N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide.
Molecular Properties
| Compound Name | N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide |
| PubChem CID | 24947610 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide |
| SMILES | CC(C)(CC(=O)NC1CC1)CC(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H32N2O2/c1-20(2,10-17(23)21-16-3-4-16)11-18(24)22-19-14-6-12-5-13(8-14)9-15(19)7-12/h12-16,19H,3-11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | BJIDTICCMAFUHM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide?
The IUPAC name of N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide (CID 24947610) is N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide.
What is the SMILES notation for N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide?
The canonical SMILES for N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide is CC(C)(CC(=O)NC1CC1)CC(=O)NC1C2CC3CC(C2)CC1C3.
What is the InChIKey of N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide?
The InChIKey is BJIDTICCMAFUHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N2O2/c1-20(2,10-17(23)21-16-3-4-16)11-18(24)22-19-14-6-12-5-13(8-14)9-15(19)7-12/h12-16,19H,3-11H2,1-2H3,(H,21,23)(H,22,24).
What are the key properties of N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide?
N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide has a molecular weight of 332.49 g/mol, XLogP of 3.01, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide is sourced from PubChem (CID 24947610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).