C16H16N2O2 — CID 24947825
3-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)-4,5,6,7-tetrahydro-1,2-benzoxazole (PubChem CID 24947825) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)-4,5,6,7-tetrahydro-1,2-benzoxazole.
| Compound Name | 3-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)-4,5,6,7-tetrahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 24947825 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)-4,5,6,7-tetrahydro-1,2-benzoxazole |
| SMILES | c1ccc(C2COC(c3noc4c3CCCC4)=N2)cc1 |
| InChI | InChI=1S/C16H16N2O2/c1-2-6-11(7-3-1)13-10-19-16(17-13)15-12-8-4-5-9-14(12)20-18-15/h1-3,6-7,13H,4-5,8-10H2 |
| InChIKey | FSTZIJKCSBRSEW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |