C22H20Cl2N6O4 — CID 24948455
1-N-[5-[(2,6-dichlorophenyl)carbamoyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-4-N-hydroxybenzene-1,4-dicarboxamide (PubChem CID 24948455) has the molecular formula C22H20Cl2N6O4 and a molecular weight of 503.35 g/mol. Its IUPAC name is 1-N-[5-[(2,6-dichlorophenyl)carbamoyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-4-N-hydroxybenzene-1,4-dicarboxamide.
| Compound Name | 1-N-[5-[(2,6-dichlorophenyl)carbamoyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-4-N-hydroxybenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 24948455 |
| Molecular Formula | C22H20Cl2N6O4 |
| Molecular Weight | 503.35 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 1-N-[5-[(2,6-dichlorophenyl)carbamoyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-4-N-hydroxybenzene-1,4-dicarboxamide |
| SMILES | CC1(C)c2[nH]nc(NC(=O)c3ccc(C(=O)NO)cc3)c2CN1C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H20Cl2N6O4/c1-22(2)17-13(10-30(22)21(33)25-16-14(23)4-3-5-15(16)24)18(28-27-17)26-19(31)11-6-8-12(9-7-11)20(32)29-34/h3-9,34H,10H2,1-2H3,(H,25,33)(H,29,32)(H2,26,27,28,31) |
| InChIKey | UGMWZFUNQMGINV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 139.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|