C36H39N13O4 — CID 24948615
1-[(3R)-1-[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-(2-ethyltetrazol-5-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]pyrrolidin-3-yl]-3-pyridin-3-ylurea (PubChem CID 24948615) has the molecular formula C36H39N13O4 and a molecular weight of 717.80 g/mol. Its IUPAC name is 1-[(3R)-1-[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-(2-ethyltetrazol-5-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]pyrrolidin-3-yl]-3-pyridin-3-ylurea.
| Compound Name | 1-[(3R)-1-[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-(2-ethyltetrazol-5-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]pyrrolidin-3-yl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 24948615 |
| Molecular Formula | C36H39N13O4 |
| Molecular Weight | 717.80 g/mol |
| Exact Mass | 717.32 |
| IUPAC Name | 1-[(3R)-1-[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-(2-ethyltetrazol-5-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]pyrrolidin-3-yl]-3-pyridin-3-ylurea |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(N5CC[C@@H](NC(=O)Nc6cccnc6)C5)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C36H39N13O4/c1-2-49-45-32(44-46-49)30-28(50)29(51)34(53-30)48-21-39-27-31(38-19-26(22-10-5-3-6-11-22)23-12-7-4-8-13-23)42-35(43-33(27)48)47-17-15-25(20-47)41-36(52)40-24-14-9-16-37-18-24/h3-14,16,18,21,25-26,28-30,34,50-51H,2,15,17,19-20H2,1H3,(H,38,42,43)(H2,40,41,52)/t25-,28+,29-,30+,34-/m1/s1 |
| InChIKey | FTAWWXFZVROGIO-YCIQATOJSA-N |
| XLogP | 2.86 |
| TPSA | 206.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |