C21H24N4O — CID 24948917
1-(2-methyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)-7-phenylheptan-1-one (PubChem CID 24948917) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-(2-methyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)-7-phenylheptan-1-one.
| Compound Name | 1-(2-methyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)-7-phenylheptan-1-one |
|---|---|
| PubChem CID | 24948917 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-(2-methyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)-7-phenylheptan-1-one |
| SMILES | Cn1nc(-c2ccccn2)nc1C(=O)CCCCCCc1ccccc1 |
| InChI | InChI=1S/C21H24N4O/c1-25-21(23-20(24-25)18-14-9-10-16-22-18)19(26)15-8-3-2-5-11-17-12-6-4-7-13-17/h4,6-7,9-10,12-14,16H,2-3,5,8,11,15H2,1H3 |
| InChIKey | HQNUGFCGGBTJRR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|