C27H22Cl2F2N2O3 — CID 24948966
(3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(2,3-difluoro-6-propan-2-yloxyphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 24948966) has the molecular formula C27H22Cl2F2N2O3 and a molecular weight of 531.39 g/mol. Its IUPAC name is (3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(2,3-difluoro-6-propan-2-yloxyphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(2,3-difluoro-6-propan-2-yloxyphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 24948966 |
| Molecular Formula | C27H22Cl2F2N2O3 |
| Molecular Weight | 531.39 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | (3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(2,3-difluoro-6-propan-2-yloxyphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | CC(C)Oc1ccc(F)c(F)c1[C@H]1NC(=O)C[C@@H](c2cccc(Cl)c2)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C27H22Cl2F2N2O3/c1-13(2)36-21-9-8-19(30)24(31)23(21)25-27(17-7-6-16(29)11-20(17)32-26(27)35)18(12-22(34)33-25)14-4-3-5-15(28)10-14/h3-11,13,18,25H,12H2,1-2H3,(H,32,35)(H,33,34)/t18-,25+,27-/m0/s1 |
| InChIKey | XYBZUIGGGHNCLJ-IPEONRORSA-N |
| XLogP | 6.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.39 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |