trimethyl(octyl)azanium chloride

C11H26ClN — CID 24949

IUPACtrimethyl(octyl)azanium chloride
SMILESCCCCCCCC[N+](C)(C)C.[Cl-]
InChIInChI=1S/C11H26N.ClH/c1-5-6-7-8-9-10-11-12(2,3)4;/h5-11H2,1-4H3;1H/q+1;/p-1
InChIKeyAQZSPJRLCJSOED-UHFFFAOYSA-M
MW207.79 g/mol
LogP0.06
Rot. Bonds7

About trimethyl(octyl)azanium chloride

trimethyl(octyl)azanium chloride (PubChem CID 24949) has the molecular formula C11H26ClN and a molecular weight of 207.79 g/mol. Its IUPAC name is trimethyl(octyl)azanium chloride.

Molecular Properties

Compound Nametrimethyl(octyl)azanium chloride
PubChem CID24949
Molecular FormulaC11H26ClN
Molecular Weight207.79 g/mol
Exact Mass207.18
IUPAC Nametrimethyl(octyl)azanium chloride
SMILESCCCCCCCC[N+](C)(C)C.[Cl-]
InChIInChI=1S/C11H26N.ClH/c1-5-6-7-8-9-10-11-12(2,3)4;/h5-11H2,1-4H3;1H/q+1;/p-1
InChIKeyAQZSPJRLCJSOED-UHFFFAOYSA-M
XLogP0.06
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds7
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.79
LogP ≤ 50.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze trimethyl(octyl)azanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trimethyl(octyl)azanium chloride?
The IUPAC name of trimethyl(octyl)azanium chloride (CID 24949) is trimethyl(octyl)azanium chloride.
What is the SMILES notation for trimethyl(octyl)azanium chloride?
The canonical SMILES for trimethyl(octyl)azanium chloride is CCCCCCCC[N+](C)(C)C.[Cl-].
What is the InChIKey of trimethyl(octyl)azanium chloride?
The InChIKey is AQZSPJRLCJSOED-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H26N.ClH/c1-5-6-7-8-9-10-11-12(2,3)4;/h5-11H2,1-4H3;1H/q+1;/p-1.
What are the key properties of trimethyl(octyl)azanium chloride?
trimethyl(octyl)azanium chloride has a molecular weight of 207.79 g/mol, XLogP of 0.06, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(octyl)azanium chloride is sourced from PubChem (CID 24949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).