About trimethyl(octyl)azanium chloride
trimethyl(octyl)azanium chloride (PubChem CID 24949) has the molecular formula C11H26ClN
and a molecular weight of 207.79 g/mol. Its IUPAC name is trimethyl(octyl)azanium chloride.
Molecular Properties
| Compound Name | trimethyl(octyl)azanium chloride |
| PubChem CID | 24949 |
| Molecular Formula | C11H26ClN |
| Molecular Weight | 207.79 g/mol |
| Exact Mass | 207.18 |
| IUPAC Name | trimethyl(octyl)azanium chloride |
| SMILES | CCCCCCCC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C11H26N.ClH/c1-5-6-7-8-9-10-11-12(2,3)4;/h5-11H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | AQZSPJRLCJSOED-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.79 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(octyl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(octyl)azanium chloride?
The IUPAC name of trimethyl(octyl)azanium chloride (CID 24949) is trimethyl(octyl)azanium chloride.
What is the SMILES notation for trimethyl(octyl)azanium chloride?
The canonical SMILES for trimethyl(octyl)azanium chloride is CCCCCCCC[N+](C)(C)C.[Cl-].
What is the InChIKey of trimethyl(octyl)azanium chloride?
The InChIKey is AQZSPJRLCJSOED-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H26N.ClH/c1-5-6-7-8-9-10-11-12(2,3)4;/h5-11H2,1-4H3;1H/q+1;/p-1.
What are the key properties of trimethyl(octyl)azanium chloride?
trimethyl(octyl)azanium chloride has a molecular weight of 207.79 g/mol, XLogP of 0.06, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(octyl)azanium chloride is sourced from PubChem (CID 24949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).