C20H27ClO4Si — CID 24949046
methyl (4aR,8aS)-2-(4-chlorophenyl)-8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydrochromene-3-carboxylate (PubChem CID 24949046) has the molecular formula C20H27ClO4Si and a molecular weight of 394.97 g/mol. Its IUPAC name is methyl (4aR,8aS)-2-(4-chlorophenyl)-8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydrochromene-3-carboxylate.
| Compound Name | methyl (4aR,8aS)-2-(4-chlorophenyl)-8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 24949046 |
| Molecular Formula | C20H27ClO4Si |
| Molecular Weight | 394.97 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | methyl (4aR,8aS)-2-(4-chlorophenyl)-8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydrochromene-3-carboxylate |
| SMILES | COC(=O)C1=C(c2ccc(Cl)cc2)O[C@]2(O[Si](C)(C)C)CCCC[C@@H]2C1 |
| InChI | InChI=1S/C20H27ClO4Si/c1-23-19(22)17-13-15-7-5-6-12-20(15,25-26(2,3)4)24-18(17)14-8-10-16(21)11-9-14/h8-11,15H,5-7,12-13H2,1-4H3/t15-,20+/m1/s1 |
| InChIKey | GSQHEFXDHYVGNE-QRWLVFNGSA-N |
| XLogP | 5.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.97 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|