C20H20IN3O2 — CID 24949224
1-[3-(6-iodo-2-pyridinyl)-1,2,4-oxadiazol-5-yl]-7-phenylheptan-1-one (PubChem CID 24949224) has the molecular formula C20H20IN3O2 and a molecular weight of 461.30 g/mol. Its IUPAC name is 1-[3-(6-iodo-2-pyridinyl)-1,2,4-oxadiazol-5-yl]-7-phenylheptan-1-one.
| Compound Name | 1-[3-(6-iodo-2-pyridinyl)-1,2,4-oxadiazol-5-yl]-7-phenylheptan-1-one |
|---|---|
| PubChem CID | 24949224 |
| Molecular Formula | C20H20IN3O2 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 1-[3-(6-iodo-2-pyridinyl)-1,2,4-oxadiazol-5-yl]-7-phenylheptan-1-one |
| SMILES | O=C(CCCCCCc1ccccc1)c1nc(-c2cccc(I)n2)no1 |
| InChI | InChI=1S/C20H20IN3O2/c21-18-14-8-12-16(22-18)19-23-20(26-24-19)17(25)13-7-2-1-4-9-15-10-5-3-6-11-15/h3,5-6,8,10-12,14H,1-2,4,7,9,13H2 |
| InChIKey | NRLHNLPAWVGHHY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|