C25H24N4O — CID 24949242
10-[(4-methylpiperazin-1-yl)methyl]-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15,17,19-nonaen-14-one (PubChem CID 24949242) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is 10-[(4-methylpiperazin-1-yl)methyl]-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15,17,19-nonaen-14-one.
| Compound Name | 10-[(4-methylpiperazin-1-yl)methyl]-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15,17,19-nonaen-14-one |
|---|---|
| PubChem CID | 24949242 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 10-[(4-methylpiperazin-1-yl)methyl]-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15,17,19-nonaen-14-one |
| SMILES | CN1CCN(Cc2c3c(nc4ccccc24)-c2cc4ccccc4c(=O)n2C3)CC1 |
| InChI | InChI=1S/C25H24N4O/c1-27-10-12-28(13-11-27)15-20-19-8-4-5-9-22(19)26-24-21(20)16-29-23(24)14-17-6-2-3-7-18(17)25(29)30/h2-9,14H,10-13,15-16H2,1H3 |
| InChIKey | JWDLGWZMFTWREQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |