C34H35Cl2F2N3O4 — CID 24949275
(3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(2,3-difluoro-6-propan-2-yloxyphenyl)-1'-(3-morpholin-4-ylpropyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 24949275) has the molecular formula C34H35Cl2F2N3O4 and a molecular weight of 658.57 g/mol. Its IUPAC name is (3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(2,3-difluoro-6-propan-2-yloxyphenyl)-1'-(3-morpholin-4-ylpropyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(2,3-difluoro-6-propan-2-yloxyphenyl)-1'-(3-morpholin-4-ylpropyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 24949275 |
| Molecular Formula | C34H35Cl2F2N3O4 |
| Molecular Weight | 658.57 g/mol |
| Exact Mass | 657.20 |
| IUPAC Name | (3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(2,3-difluoro-6-propan-2-yloxyphenyl)-1'-(3-morpholin-4-ylpropyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | CC(C)Oc1ccc(F)c(F)c1[C@H]1N(CCCN2CCOCC2)C(=O)C[C@@H](c2cccc(Cl)c2)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C34H35Cl2F2N3O4/c1-20(2)45-28-10-9-26(37)31(38)30(28)32-34(24-8-7-23(36)18-27(24)39-33(34)43)25(21-5-3-6-22(35)17-21)19-29(42)41(32)12-4-11-40-13-15-44-16-14-40/h3,5-10,17-18,20,25,32H,4,11-16,19H2,1-2H3,(H,39,43)/t25-,32+,34-/m0/s1 |
| InChIKey | KANKSHVXXKXNGA-WQNHRVCHSA-N |
| XLogP | 6.73 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |