C22H19N3O — CID 24949391
10-[(dimethylamino)methyl]-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15,17,19-nonaen-14-one (PubChem CID 24949391) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is 10-[(dimethylamino)methyl]-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15,17,19-nonaen-14-one.
| Compound Name | 10-[(dimethylamino)methyl]-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15,17,19-nonaen-14-one |
|---|---|
| PubChem CID | 24949391 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 10-[(dimethylamino)methyl]-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15,17,19-nonaen-14-one |
| SMILES | CN(C)Cc1c2c(nc3ccccc13)-c1cc3ccccc3c(=O)n1C2 |
| InChI | InChI=1S/C22H19N3O/c1-24(2)12-17-16-9-5-6-10-19(16)23-21-18(17)13-25-20(21)11-14-7-3-4-8-15(14)22(25)26/h3-11H,12-13H2,1-2H3 |
| InChIKey | ASXUODGQRUMRDS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |