C24H23ClN2O4 — CID 24949572
3-[[(7S)-7-[[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]benzoic acid (PubChem CID 24949572) has the molecular formula C24H23ClN2O4 and a molecular weight of 438.91 g/mol. Its IUPAC name is 3-[[(7S)-7-[[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]benzoic acid.
| Compound Name | 3-[[(7S)-7-[[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 24949572 |
| Molecular Formula | C24H23ClN2O4 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 3-[[(7S)-7-[[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]benzoic acid |
| SMILES | O=C(O)c1cccc(Oc2ccc3c(c2)C[C@@H](NC[C@H](O)c2ccc(Cl)nc2)CC3)c1 |
| InChI | InChI=1S/C24H23ClN2O4/c25-23-9-6-17(13-27-23)22(28)14-26-19-7-4-15-5-8-21(12-18(15)10-19)31-20-3-1-2-16(11-20)24(29)30/h1-3,5-6,8-9,11-13,19,22,26,28H,4,7,10,14H2,(H,29,30)/t19-,22-/m0/s1 |
| InChIKey | MNUKAUHYDBVOLU-UGKGYDQZSA-N |
| XLogP | 4.41 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|