C16H16O7 — CID 24949851
(3R,4S)-3-[(3,4-dihydroxyphenyl)methyl]-2,4-dihydrochromene-3,4,7,8-tetrol (PubChem CID 24949851) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is (3R,4S)-3-[(3,4-dihydroxyphenyl)methyl]-2,4-dihydrochromene-3,4,7,8-tetrol.
| Compound Name | (3R,4S)-3-[(3,4-dihydroxyphenyl)methyl]-2,4-dihydrochromene-3,4,7,8-tetrol |
|---|---|
| PubChem CID | 24949851 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (3R,4S)-3-[(3,4-dihydroxyphenyl)methyl]-2,4-dihydrochromene-3,4,7,8-tetrol |
| SMILES | Oc1ccc(C[C@@]2(O)COc3c(ccc(O)c3O)[C@@H]2O)cc1O |
| InChI | InChI=1S/C16H16O7/c17-10-3-1-8(5-12(10)19)6-16(22)7-23-14-9(15(16)21)2-4-11(18)13(14)20/h1-5,15,17-22H,6-7H2/t15-,16+/m0/s1 |
| InChIKey | FUVGPYLFLOWRMC-JKSUJKDBSA-N |
| XLogP | 0.91 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|