About N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine
N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine (PubChem CID 24950183) has the molecular formula C22H28ClN3
and a molecular weight of 369.94 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine |
| PubChem CID | 24950183 |
| Molecular Formula | C22H28ClN3 |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine |
| SMILES | Clc1ccc2c(NCCNCC34CC5CC(CC(C5)C3)C4)ccnc2c1 |
| InChI | InChI=1S/C22H28ClN3/c23-18-1-2-19-20(3-4-25-21(19)10-18)26-6-5-24-14-22-11-15-7-16(12-22)9-17(8-15)13-22/h1-4,10,15-17,24H,5-9,11-14H2,(H,25,26) |
| InChIKey | XROLUQWWPXRCJD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine?
The IUPAC name of N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine (CID 24950183) is N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine?
The canonical SMILES for N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine is Clc1ccc2c(NCCNCC34CC5CC(CC(C5)C3)C4)ccnc2c1.
What is the InChIKey of N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine?
The InChIKey is XROLUQWWPXRCJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28ClN3/c23-18-1-2-19-20(3-4-25-21(19)10-18)26-6-5-24-14-22-11-15-7-16(12-22)9-17(8-15)13-22/h1-4,10,15-17,24H,5-9,11-14H2,(H,25,26).
What are the key properties of N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine?
N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine has a molecular weight of 369.94 g/mol, XLogP of 5.11, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantylmethyl)-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 24950183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).