C12H15NO2 — CID 24950316
(E)-3-[4-[(dimethylamino)methyl]phenyl]prop-2-enoic acid (PubChem CID 24950316) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (E)-3-[4-[(dimethylamino)methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(dimethylamino)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 24950316 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (E)-3-[4-[(dimethylamino)methyl]phenyl]prop-2-enoic acid |
| SMILES | CN(C)Cc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C12H15NO2/c1-13(2)9-11-5-3-10(4-6-11)7-8-12(14)15/h3-8H,9H2,1-2H3,(H,14,15)/b8-7+ |
| InChIKey | LKNPKKBYMBUIOU-BQYQJAHWSA-N |
| XLogP | 1.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|