About 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide
2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide (PubChem CID 24950386) has the molecular formula C23H17NO4
and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide.
Molecular Properties
| Compound Name | 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide |
| PubChem CID | 24950386 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide |
| SMILES | O=C(Nc1cccc(O)c1)c1c(O)ccc2cc(-c3cccc(O)c3)ccc12 |
| InChI | InChI=1S/C23H17NO4/c25-18-5-1-3-14(12-18)15-7-9-20-16(11-15)8-10-21(27)22(20)23(28)24-17-4-2-6-19(26)13-17/h1-13,25-27H,(H,24,28) |
| InChIKey | JFOMBBOIWCMHKV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide?
The IUPAC name of 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide (CID 24950386) is 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide.
What is the SMILES notation for 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide?
The canonical SMILES for 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide is O=C(Nc1cccc(O)c1)c1c(O)ccc2cc(-c3cccc(O)c3)ccc12.
What is the InChIKey of 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide?
The InChIKey is JFOMBBOIWCMHKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO4/c25-18-5-1-3-14(12-18)15-7-9-20-16(11-15)8-10-21(27)22(20)23(28)24-17-4-2-6-19(26)13-17/h1-13,25-27H,(H,24,28).
What are the key properties of 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide?
2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide has a molecular weight of 371.39 g/mol, XLogP of 4.88, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N,6-bis(3-hydroxyphenyl)naphthalene-1-carboxamide is sourced from PubChem (CID 24950386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).