C15H19N3O — CID 24950681
7-phenyl-1-(1H-1,2,4-triazol-5-yl)heptan-1-one (PubChem CID 24950681) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 7-phenyl-1-(1H-1,2,4-triazol-5-yl)heptan-1-one.
| Compound Name | 7-phenyl-1-(1H-1,2,4-triazol-5-yl)heptan-1-one |
|---|---|
| PubChem CID | 24950681 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 7-phenyl-1-(1H-1,2,4-triazol-5-yl)heptan-1-one |
| SMILES | O=C(CCCCCCc1ccccc1)c1ncn[nH]1 |
| InChI | InChI=1S/C15H19N3O/c19-14(15-16-12-17-18-15)11-7-2-1-4-8-13-9-5-3-6-10-13/h3,5-6,9-10,12H,1-2,4,7-8,11H2,(H,16,17,18) |
| InChIKey | QGFMPQSHPGJYBF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|