C20H30N4O2 — CID 24950731
(E)-3-[2-tert-butyl-3-[(2,2-dimethylpropylamino)methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide (PubChem CID 24950731) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is (E)-3-[2-tert-butyl-3-[(2,2-dimethylpropylamino)methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-tert-butyl-3-[(2,2-dimethylpropylamino)methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 24950731 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (E)-3-[2-tert-butyl-3-[(2,2-dimethylpropylamino)methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
| SMILES | CC(C)(C)CNCc1c(C(C)(C)C)nc2cc(/C=C/C(=O)NO)ccn12 |
| InChI | InChI=1S/C20H30N4O2/c1-19(2,3)13-21-12-15-18(20(4,5)6)22-16-11-14(9-10-24(15)16)7-8-17(25)23-26/h7-11,21,26H,12-13H2,1-6H3,(H,23,25)/b8-7+ |
| InChIKey | YJZCXXRMXYFWRV-BQYQJAHWSA-N |
| XLogP | 3.29 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|