C21H34O3 — CID 24950832
(6E,10S,11S,14E,15aS)-10-methoxy-3,6,10,14-tetramethyl-4,5,8,9,11,12,13,15a-octahydro-2H-cyclotetradeca[b]furan-11-ol (PubChem CID 24950832) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (6E,10S,11S,14E,15aS)-10-methoxy-3,6,10,14-tetramethyl-4,5,8,9,11,12,13,15a-octahydro-2H-cyclotetradeca[b]furan-11-ol.
| Compound Name | (6E,10S,11S,14E,15aS)-10-methoxy-3,6,10,14-tetramethyl-4,5,8,9,11,12,13,15a-octahydro-2H-cyclotetradeca[b]furan-11-ol |
|---|---|
| PubChem CID | 24950832 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (6E,10S,11S,14E,15aS)-10-methoxy-3,6,10,14-tetramethyl-4,5,8,9,11,12,13,15a-octahydro-2H-cyclotetradeca[b]furan-11-ol |
| SMILES | CO[C@@]1(C)CC/C=C(\C)CCC2=C(C)CO[C@H]2/C=C(\C)CC[C@@H]1O |
| InChI | InChI=1S/C21H34O3/c1-15-7-6-12-21(4,23-5)20(22)11-9-16(2)13-19-18(10-8-15)17(3)14-24-19/h7,13,19-20,22H,6,8-12,14H2,1-5H3/b15-7+,16-13+/t19-,20-,21-/m0/s1 |
| InChIKey | LRMBVPPNMSRMSA-HJJBTCMOSA-N |
| XLogP | 4.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|