C20H30O2 — CID 24950833
[(6E,10Z,14E,15aS)-6,10,14-trimethyl-2,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-3-yl]methanol (PubChem CID 24950833) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is [(6E,10Z,14E,15aS)-6,10,14-trimethyl-2,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-3-yl]methanol.
| Compound Name | [(6E,10Z,14E,15aS)-6,10,14-trimethyl-2,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-3-yl]methanol |
|---|---|
| PubChem CID | 24950833 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | [(6E,10Z,14E,15aS)-6,10,14-trimethyl-2,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-3-yl]methanol |
| SMILES | C/C1=C/CC/C(C)=C/[C@@H]2OCC(CO)=C2CC/C(C)=C/CC1 |
| InChI | InChI=1S/C20H30O2/c1-15-6-4-8-16(2)10-11-19-18(13-21)14-22-20(19)12-17(3)9-5-7-15/h7-8,12,20-21H,4-6,9-11,13-14H2,1-3H3/b15-7-,16-8+,17-12+/t20-/m0/s1 |
| InChIKey | DBNCAIQJJKDMHN-FXTGKKEZSA-N |
| XLogP | 4.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|