C22H23N3O4 — CID 24950843
methyl 6-[5-(7-phenylheptanoyl)-1,3,4-oxadiazol-2-yl]pyridine-2-carboxylate (PubChem CID 24950843) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is methyl 6-[5-(7-phenylheptanoyl)-1,3,4-oxadiazol-2-yl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[5-(7-phenylheptanoyl)-1,3,4-oxadiazol-2-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 24950843 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | methyl 6-[5-(7-phenylheptanoyl)-1,3,4-oxadiazol-2-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(-c2nnc(C(=O)CCCCCCc3ccccc3)o2)n1 |
| InChI | InChI=1S/C22H23N3O4/c1-28-22(27)18-14-9-13-17(23-18)20-24-25-21(29-20)19(26)15-8-3-2-5-10-16-11-6-4-7-12-16/h4,6-7,9,11-14H,2-3,5,8,10,15H2,1H3 |
| InChIKey | JKQNNHXFHZHSAS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 95.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|