C25H40N6O — CID 24950876
N-[4,6-dimethyl-1-octyl-5-(2H-tetrazol-5-ylmethyl)-2,3-dihydroindol-7-yl]-2,2-dimethylpropanamide (PubChem CID 24950876) has the molecular formula C25H40N6O and a molecular weight of 440.64 g/mol. Its IUPAC name is N-[4,6-dimethyl-1-octyl-5-(2H-tetrazol-5-ylmethyl)-2,3-dihydroindol-7-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[4,6-dimethyl-1-octyl-5-(2H-tetrazol-5-ylmethyl)-2,3-dihydroindol-7-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 24950876 |
| Molecular Formula | C25H40N6O |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | N-[4,6-dimethyl-1-octyl-5-(2H-tetrazol-5-ylmethyl)-2,3-dihydroindol-7-yl]-2,2-dimethylpropanamide |
| SMILES | CCCCCCCCN1CCc2c(C)c(Cc3nn[nH]n3)c(C)c(NC(=O)C(C)(C)C)c21 |
| InChI | InChI=1S/C25H40N6O/c1-7-8-9-10-11-12-14-31-15-13-19-17(2)20(16-21-27-29-30-28-21)18(3)22(23(19)31)26-24(32)25(4,5)6/h7-16H2,1-6H3,(H,26,32)(H,27,28,29,30) |
| InChIKey | VOLIANOPMZYRIU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|