About ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate
ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate (PubChem CID 24950974) has the molecular formula C20H16ClN3O4
and a molecular weight of 397.82 g/mol. Its IUPAC name is ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate |
| PubChem CID | 24950974 |
| Molecular Formula | C20H16ClN3O4 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate |
| SMILES | CCOC(=O)C1=C(N)n2c(=O)c3ccccc3c(=O)n2C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H16ClN3O4/c1-2-28-20(27)15-16(11-7-9-12(21)10-8-11)23-18(25)13-5-3-4-6-14(13)19(26)24(23)17(15)22/h3-10,16H,2,22H2,1H3 |
| InChIKey | LZPKZSXCEVTCRC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate?
The IUPAC name of ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate (CID 24950974) is ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate.
What is the SMILES notation for ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate?
The canonical SMILES for ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate is CCOC(=O)C1=C(N)n2c(=O)c3ccccc3c(=O)n2C1c1ccc(Cl)cc1.
What is the InChIKey of ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate?
The InChIKey is LZPKZSXCEVTCRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3O4/c1-2-28-20(27)15-16(11-7-9-12(21)10-8-11)23-18(25)13-5-3-4-6-14(13)19(26)24(23)17(15)22/h3-10,16H,2,22H2,1H3.
What are the key properties of ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate?
ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate has a molecular weight of 397.82 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-amino-1-(4-chlorophenyl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carboxylate is sourced from PubChem (CID 24950974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).