C19H20N2O3 — CID 24951002
1-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]-7-phenylheptan-1-one (PubChem CID 24951002) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]-7-phenylheptan-1-one.
| Compound Name | 1-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]-7-phenylheptan-1-one |
|---|---|
| PubChem CID | 24951002 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]-7-phenylheptan-1-one |
| SMILES | O=C(CCCCCCc1ccccc1)c1nc(-c2ccco2)no1 |
| InChI | InChI=1S/C19H20N2O3/c22-16(19-20-18(21-24-19)17-13-8-14-23-17)12-7-2-1-4-9-15-10-5-3-6-11-15/h3,5-6,8,10-11,13-14H,1-2,4,7,9,12H2 |
| InChIKey | DRXUVAUJQLMZPP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|