C20H21N3O2 — CID 24951156
7-phenyl-1-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)heptan-1-one (PubChem CID 24951156) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 7-phenyl-1-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)heptan-1-one.
| Compound Name | 7-phenyl-1-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)heptan-1-one |
|---|---|
| PubChem CID | 24951156 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 7-phenyl-1-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)heptan-1-one |
| SMILES | O=C(CCCCCCc1ccccc1)c1noc(-c2ccccn2)n1 |
| InChI | InChI=1S/C20H21N3O2/c24-18(14-7-2-1-4-10-16-11-5-3-6-12-16)19-22-20(25-23-19)17-13-8-9-15-21-17/h3,5-6,8-9,11-13,15H,1-2,4,7,10,14H2 |
| InChIKey | ZGRRWAAITBLGLH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|