C19H20N2O2S — CID 24951158
7-phenyl-1-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)heptan-1-one (PubChem CID 24951158) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 7-phenyl-1-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)heptan-1-one.
| Compound Name | 7-phenyl-1-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)heptan-1-one |
|---|---|
| PubChem CID | 24951158 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 7-phenyl-1-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)heptan-1-one |
| SMILES | O=C(CCCCCCc1ccccc1)c1noc(-c2cccs2)n1 |
| InChI | InChI=1S/C19H20N2O2S/c22-16(18-20-19(23-21-18)17-13-8-14-24-17)12-7-2-1-4-9-15-10-5-3-6-11-15/h3,5-6,8,10-11,13-14H,1-2,4,7,9,12H2 |
| InChIKey | ZFZWXQBOEMXRFD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|