C22H30N4O6 — CID 24951312
tert-butyl N-[3-[3-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,2-oxazol-5-yl]phenyl]carbamate (PubChem CID 24951312) has the molecular formula C22H30N4O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,2-oxazol-5-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,2-oxazol-5-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 24951312 |
| Molecular Formula | C22H30N4O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | tert-butyl N-[3-[3-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,2-oxazol-5-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(-c2cc(C(=O)NCCCCCCC(=O)NO)no2)c1 |
| InChI | InChI=1S/C22H30N4O6/c1-22(2,3)31-21(29)24-16-10-8-9-15(13-16)18-14-17(26-32-18)20(28)23-12-7-5-4-6-11-19(27)25-30/h8-10,13-14,30H,4-7,11-12H2,1-3H3,(H,23,28)(H,24,29)(H,25,27) |
| InChIKey | TVNHLWWJVGGFQS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 142.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|