C21H21N3O3S — CID 24951318
6-[5-(7-phenylheptanoyl)-1,3,4-thiadiazol-2-yl]pyridine-2-carboxylic acid (PubChem CID 24951318) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 6-[5-(7-phenylheptanoyl)-1,3,4-thiadiazol-2-yl]pyridine-2-carboxylic acid.
| Compound Name | 6-[5-(7-phenylheptanoyl)-1,3,4-thiadiazol-2-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 24951318 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 6-[5-(7-phenylheptanoyl)-1,3,4-thiadiazol-2-yl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(-c2nnc(C(=O)CCCCCCc3ccccc3)s2)n1 |
| InChI | InChI=1S/C21H21N3O3S/c25-18(14-7-2-1-4-9-15-10-5-3-6-11-15)20-24-23-19(28-20)16-12-8-13-17(22-16)21(26)27/h3,5-6,8,10-13H,1-2,4,7,9,14H2,(H,26,27) |
| InChIKey | XAIQJURMPNPAKU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|