C24H24N2O2 — CID 24951549
1,1,4a-trimethyl-2,6-dioxo-8a-[2-(1H-pyrrol-2-yl)ethynyl]-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile (PubChem CID 24951549) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1,1,4a-trimethyl-2,6-dioxo-8a-[2-(1H-pyrrol-2-yl)ethynyl]-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile.
| Compound Name | 1,1,4a-trimethyl-2,6-dioxo-8a-[2-(1H-pyrrol-2-yl)ethynyl]-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 24951549 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1,1,4a-trimethyl-2,6-dioxo-8a-[2-(1H-pyrrol-2-yl)ethynyl]-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=CC2(C)C3=CC(=O)CCC3(C#Cc3ccc[nH]3)CCC12 |
| InChI | InChI=1S/C24H24N2O2/c1-22(2)19-8-11-24(9-6-17-5-4-12-26-17)10-7-18(27)13-20(24)23(19,3)14-16(15-25)21(22)28/h4-5,12-14,19,26H,7-8,10-11H2,1-3H3 |
| InChIKey | VXVVDSMVCKPCPM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|