C17H22Cl2N4O4S — CID 24952020
2-[[1-(3,4-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-diethylethanamine;oxalic acid (PubChem CID 24952020) has the molecular formula C17H22Cl2N4O4S and a molecular weight of 449.36 g/mol. Its IUPAC name is 2-[[1-(3,4-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-diethylethanamine;oxalic acid.
| Compound Name | 2-[[1-(3,4-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-diethylethanamine;oxalic acid |
|---|---|
| PubChem CID | 24952020 |
| Molecular Formula | C17H22Cl2N4O4S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 2-[[1-(3,4-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-diethylethanamine;oxalic acid |
| SMILES | CCN(CC)CCSc1nc(C)n(-c2ccc(Cl)c(Cl)c2)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H20Cl2N4S.C2H2O4/c1-4-20(5-2)8-9-22-15-18-11(3)21(19-15)12-6-7-13(16)14(17)10-12;3-1(4)2(5)6/h6-7,10H,4-5,8-9H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | TYEXKKGYEQAEJP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|