C22H19NO4 — CID 24952085
(1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(1H-indol-6-yl)hepta-1,6-diene-3,5-dione (PubChem CID 24952085) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(1H-indol-6-yl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(1H-indol-6-yl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 24952085 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(1H-indol-6-yl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc3cc[nH]c3c2)ccc1O |
| InChI | InChI=1S/C22H19NO4/c1-27-22-13-16(5-9-21(22)26)4-8-19(25)14-18(24)7-3-15-2-6-17-10-11-23-20(17)12-15/h2-13,23,26H,14H2,1H3/b7-3+,8-4+ |
| InChIKey | SIABTKWBOMYBGS-FCXRPNKRSA-N |
| XLogP | 4.14 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|