C21H28F3NO3 — CID 24952151
3-[2-[(5R,8aS)-5,8a-dimethyl-2-methylidene-6-oxo-3,4,4a,5,7,8-hexahydro-1H-naphthalen-1-yl]-1-(2,2,2-trifluoroethylamino)ethyl]-3H-furan-2-one (PubChem CID 24952151) has the molecular formula C21H28F3NO3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-[2-[(5R,8aS)-5,8a-dimethyl-2-methylidene-6-oxo-3,4,4a,5,7,8-hexahydro-1H-naphthalen-1-yl]-1-(2,2,2-trifluoroethylamino)ethyl]-3H-furan-2-one.
| Compound Name | 3-[2-[(5R,8aS)-5,8a-dimethyl-2-methylidene-6-oxo-3,4,4a,5,7,8-hexahydro-1H-naphthalen-1-yl]-1-(2,2,2-trifluoroethylamino)ethyl]-3H-furan-2-one |
|---|---|
| PubChem CID | 24952151 |
| Molecular Formula | C21H28F3NO3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 3-[2-[(5R,8aS)-5,8a-dimethyl-2-methylidene-6-oxo-3,4,4a,5,7,8-hexahydro-1H-naphthalen-1-yl]-1-(2,2,2-trifluoroethylamino)ethyl]-3H-furan-2-one |
| SMILES | C=C1CCC2[C@@H](C)C(=O)CC[C@]2(C)C1CC(NCC(F)(F)F)C1C=COC1=O |
| InChI | InChI=1S/C21H28F3NO3/c1-12-4-5-15-13(2)18(26)6-8-20(15,3)16(12)10-17(25-11-21(22,23)24)14-7-9-28-19(14)27/h7,9,13-17,25H,1,4-6,8,10-11H2,2-3H3/t13-,14?,15?,16?,17?,20+/m1/s1 |
| InChIKey | MPKBKKPIWSUZAS-AFXUECKCSA-N |
| XLogP | 4.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|