C15H12ClN3O — CID 24952622
4-chloro-17-methyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,11,13,15-hexaen-6-one (PubChem CID 24952622) has the molecular formula C15H12ClN3O and a molecular weight of 285.73 g/mol. Its IUPAC name is 4-chloro-17-methyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,11,13,15-hexaen-6-one.
| Compound Name | 4-chloro-17-methyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,11,13,15-hexaen-6-one |
|---|---|
| PubChem CID | 24952622 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-chloro-17-methyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,11,13,15-hexaen-6-one |
| SMILES | Cn1c2c(c3ccccc31)CCn1c-2cc(Cl)nc1=O |
| InChI | InChI=1S/C15H12ClN3O/c1-18-11-5-3-2-4-9(11)10-6-7-19-12(14(10)18)8-13(16)17-15(19)20/h2-5,8H,6-7H2,1H3 |
| InChIKey | XLKATAJWVAYWCV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|