About 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one
3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 24952763) has the molecular formula C20H15F2N3OS
and a molecular weight of 383.42 g/mol. Its IUPAC name is 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 24952763 |
| Molecular Formula | C20H15F2N3OS |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(CSc2cccc(F)c2F)nc2c(Cc3ccccc3)c[nH]n12 |
| InChI | InChI=1S/C20H15F2N3OS/c21-16-7-4-8-17(19(16)22)27-12-15-10-18(26)25-20(24-15)14(11-23-25)9-13-5-2-1-3-6-13/h1-8,10-11,23H,9,12H2 |
| InChIKey | PABPMMBJNUIUBZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 24952763) is 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one is O=c1cc(CSc2cccc(F)c2F)nc2c(Cc3ccccc3)c[nH]n12.
What is the InChIKey of 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is PABPMMBJNUIUBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2N3OS/c21-16-7-4-8-17(19(16)22)27-12-15-10-18(26)25-20(24-15)14(11-23-25)9-13-5-2-1-3-6-13/h1-8,10-11,23H,9,12H2.
What are the key properties of 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 383.42 g/mol, XLogP of 4.18, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-5-[(2,3-difluorophenyl)sulfanylmethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 24952763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).