C21H16N2O3S — CID 24952780
5-[2-(3-hydroxyphenyl)ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide (PubChem CID 24952780) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is 5-[2-(3-hydroxyphenyl)ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide.
| Compound Name | 5-[2-(3-hydroxyphenyl)ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24952780 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 5-[2-(3-hydroxyphenyl)ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide |
| SMILES | C[S@@](=O)(=NC(=O)c1cncc(C#Cc2cccc(O)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C21H16N2O3S/c1-27(26,20-8-3-2-4-9-20)23-21(25)18-12-17(14-22-15-18)11-10-16-6-5-7-19(24)13-16/h2-9,12-15,24H,1H3/t27-/m0/s1 |
| InChIKey | LIGJGRBHSDRVRF-MHZLTWQESA-N |
| XLogP | 3.48 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|