C19H26ClN3O7 — CID 24953091
(2S)-2-[[(1S)-1-carboxy-5-[(3-chlorophenyl)methylamino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 24953091) has the molecular formula C19H26ClN3O7 and a molecular weight of 443.88 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-[(3-chlorophenyl)methylamino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-[(3-chlorophenyl)methylamino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 24953091 |
| Molecular Formula | C19H26ClN3O7 |
| Molecular Weight | 443.88 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-[(3-chlorophenyl)methylamino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNCc1cccc(Cl)c1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H26ClN3O7/c20-13-5-3-4-12(10-13)11-21-9-2-1-6-14(17(26)27)22-19(30)23-15(18(28)29)7-8-16(24)25/h3-5,10,14-15,21H,1-2,6-9,11H2,(H,24,25)(H,26,27)(H,28,29)(H2,22,23,30)/t14-,15-/m0/s1 |
| InChIKey | HKCPAWLISGYKTE-GJZGRUSLSA-N |
| XLogP | 1.67 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.88 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|