C27H20N2O3S — CID 24953134
N-(methyl-oxo-phenyl-λ6-sulfanylidene)-5-[2-(4-phenoxyphenyl)ethynyl]pyridine-3-carboxamide (PubChem CID 24953134) has the molecular formula C27H20N2O3S and a molecular weight of 452.54 g/mol. Its IUPAC name is N-(methyl-oxo-phenyl-λ6-sulfanylidene)-5-[2-(4-phenoxyphenyl)ethynyl]pyridine-3-carboxamide.
| Compound Name | N-(methyl-oxo-phenyl-λ6-sulfanylidene)-5-[2-(4-phenoxyphenyl)ethynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24953134 |
| Molecular Formula | C27H20N2O3S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-(methyl-oxo-phenyl-λ6-sulfanylidene)-5-[2-(4-phenoxyphenyl)ethynyl]pyridine-3-carboxamide |
| SMILES | C[S@@](=O)(=NC(=O)c1cncc(C#Cc2ccc(Oc3ccccc3)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C27H20N2O3S/c1-33(31,26-10-6-3-7-11-26)29-27(30)23-18-22(19-28-20-23)13-12-21-14-16-25(17-15-21)32-24-8-4-2-5-9-24/h2-11,14-20H,1H3/t33-/m0/s1 |
| InChIKey | DTAPMXSUJXPGDV-XIFFEERXSA-N |
| XLogP | 5.57 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|