C21H15F2N5O — CID 24953204
6-(2,4-difluorophenyl)-5-[3-(1-methylcyclopropyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]imidazo[2,1-b][1,3]oxazole (PubChem CID 24953204) has the molecular formula C21H15F2N5O and a molecular weight of 391.38 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)-5-[3-(1-methylcyclopropyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]imidazo[2,1-b][1,3]oxazole.
| Compound Name | 6-(2,4-difluorophenyl)-5-[3-(1-methylcyclopropyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 24953204 |
| Molecular Formula | C21H15F2N5O |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 6-(2,4-difluorophenyl)-5-[3-(1-methylcyclopropyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]imidazo[2,1-b][1,3]oxazole |
| SMILES | CC1(c2nnc3ccc(-c4c(-c5ccc(F)cc5F)nc5occn45)cn23)CC1 |
| InChI | InChI=1S/C21H15F2N5O/c1-21(6-7-21)19-26-25-16-5-2-12(11-28(16)19)18-17(24-20-27(18)8-9-29-20)14-4-3-13(22)10-15(14)23/h2-5,8-11H,6-7H2,1H3 |
| InChIKey | JIZUUFZFUQMTPF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 60.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |