C32H39N5O7 — CID 24953303
N,N-dimethyl-1-phenyl-4-[3-[2-(1,2,4-triazol-1-yl)ethyl]-1H-indol-2-yl]cyclohexan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 24953303) has the molecular formula C32H39N5O7 and a molecular weight of 605.69 g/mol. Its IUPAC name is N,N-dimethyl-1-phenyl-4-[3-[2-(1,2,4-triazol-1-yl)ethyl]-1H-indol-2-yl]cyclohexan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N,N-dimethyl-1-phenyl-4-[3-[2-(1,2,4-triazol-1-yl)ethyl]-1H-indol-2-yl]cyclohexan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 24953303 |
| Molecular Formula | C32H39N5O7 |
| Molecular Weight | 605.69 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | N,N-dimethyl-1-phenyl-4-[3-[2-(1,2,4-triazol-1-yl)ethyl]-1H-indol-2-yl]cyclohexan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN(C)C1(c2ccccc2)CCC(c2[nH]c3ccccc3c2CCn2cncn2)CC1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H31N5.C6H8O7/c1-30(2)26(21-8-4-3-5-9-21)15-12-20(13-16-26)25-23(14-17-31-19-27-18-28-31)22-10-6-7-11-24(22)29-25;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-11,18-20,29H,12-17H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | MHPGJFRTSIGPQX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 181.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |