C20H33NO5 — CID 24953620
(3S,6R,7S,7aR)-3-tert-butyl-7a-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-7-hydroxy-6-(2-hydroxyethyl)-7-methyl-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 24953620) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is (3S,6R,7S,7aR)-3-tert-butyl-7a-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-7-hydroxy-6-(2-hydroxyethyl)-7-methyl-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3S,6R,7S,7aR)-3-tert-butyl-7a-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-7-hydroxy-6-(2-hydroxyethyl)-7-methyl-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 24953620 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | (3S,6R,7S,7aR)-3-tert-butyl-7a-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-7-hydroxy-6-(2-hydroxyethyl)-7-methyl-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC(C)(C)[C@@H]1OC[C@]2([C@@H](O)[C@@H]3C=CCCC3)N1C(=O)[C@H](CCO)[C@]2(C)O |
| InChI | InChI=1S/C20H33NO5/c1-18(2,3)17-21-16(24)14(10-11-22)19(4,25)20(21,12-26-17)15(23)13-8-6-5-7-9-13/h6,8,13-15,17,22-23,25H,5,7,9-12H2,1-4H3/t13-,14+,15+,17+,19+,20-/m1/s1 |
| InChIKey | QFXOYVAPDNOWCZ-QTODTUCWSA-N |
| XLogP | 1.44 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|